C11H10F3O5S- — CID 174678576
[3,5-dimethyl-4-(trifluoromethyl)benzoyl]oxymethyl sulfite (PubChem CID 174678576) has the molecular formula C11H10F3O5S- and a molecular weight of 311.26 g/mol. Its IUPAC name is [3,5-dimethyl-4-(trifluoromethyl)benzoyl]oxymethyl sulfite.
| Compound Name | [3,5-dimethyl-4-(trifluoromethyl)benzoyl]oxymethyl sulfite |
|---|---|
| PubChem CID | 174678576 |
| Molecular Formula | C11H10F3O5S- |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | [3,5-dimethyl-4-(trifluoromethyl)benzoyl]oxymethyl sulfite |
| SMILES | Cc1cc(C(=O)OCOS(=O)[O-])cc(C)c1C(F)(F)F |
| InChI | InChI=1S/C11H11F3O5S/c1-6-3-8(10(15)18-5-19-20(16)17)4-7(2)9(6)11(12,13)14/h3-4H,5H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | RLBYAKNOBABFDN-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|