About 1-bromo-4-methylpentane;ethyl 2-chloropropanoate
1-bromo-4-methylpentane;ethyl 2-chloropropanoate (PubChem CID 174681358) has the molecular formula C11H22BrClO2
and a molecular weight of 301.65 g/mol. Its IUPAC name is 1-bromo-4-methylpentane;ethyl 2-chloropropanoate.
Molecular Properties
| Compound Name | 1-bromo-4-methylpentane;ethyl 2-chloropropanoate |
| PubChem CID | 174681358 |
| Molecular Formula | C11H22BrClO2 |
| Molecular Weight | 301.65 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-bromo-4-methylpentane;ethyl 2-chloropropanoate |
| SMILES | CC(C)CCCBr.CCOC(=O)C(C)Cl |
| InChI | InChI=1S/C6H13Br.C5H9ClO2/c1-6(2)4-3-5-7;1-3-8-5(7)4(2)6/h6H,3-5H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | PARQWYXQOLXVQS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-methylpentane;ethyl 2-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylpentane;ethyl 2-chloropropanoate?
The IUPAC name of 1-bromo-4-methylpentane;ethyl 2-chloropropanoate (CID 174681358) is 1-bromo-4-methylpentane;ethyl 2-chloropropanoate.
What is the SMILES notation for 1-bromo-4-methylpentane;ethyl 2-chloropropanoate?
The canonical SMILES for 1-bromo-4-methylpentane;ethyl 2-chloropropanoate is CC(C)CCCBr.CCOC(=O)C(C)Cl.
What is the InChIKey of 1-bromo-4-methylpentane;ethyl 2-chloropropanoate?
The InChIKey is PARQWYXQOLXVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13Br.C5H9ClO2/c1-6(2)4-3-5-7;1-3-8-5(7)4(2)6/h6H,3-5H2,1-2H3;4H,3H2,1-2H3.
What are the key properties of 1-bromo-4-methylpentane;ethyl 2-chloropropanoate?
1-bromo-4-methylpentane;ethyl 2-chloropropanoate has a molecular weight of 301.65 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylpentane;ethyl 2-chloropropanoate is sourced from PubChem (CID 174681358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).