About ethyl (2R)-2,5-dibromopentanoate
ethyl (2R)-2,5-dibromopentanoate (PubChem CID 98051251) has the molecular formula C7H12Br2O2
and a molecular weight of 287.98 g/mol. Its IUPAC name is ethyl (2R)-2,5-dibromopentanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2,5-dibromopentanoate |
| PubChem CID | 98051251 |
| Molecular Formula | C7H12Br2O2 |
| Molecular Weight | 287.98 g/mol |
| Exact Mass | 285.92 |
| IUPAC Name | ethyl (2R)-2,5-dibromopentanoate |
| SMILES | CCOC(=O)[C@H](Br)CCCBr |
| InChI | InChI=1S/C7H12Br2O2/c1-2-11-7(10)6(9)4-3-5-8/h6H,2-5H2,1H3/t6-/m1/s1 |
| InChIKey | IMJLPXIWIIDKHO-ZCFIWIBFSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.98 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2R)-2,5-dibromopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2,5-dibromopentanoate?
The IUPAC name of ethyl (2R)-2,5-dibromopentanoate (CID 98051251) is ethyl (2R)-2,5-dibromopentanoate.
What is the SMILES notation for ethyl (2R)-2,5-dibromopentanoate?
The canonical SMILES for ethyl (2R)-2,5-dibromopentanoate is CCOC(=O)[C@H](Br)CCCBr.
What is the InChIKey of ethyl (2R)-2,5-dibromopentanoate?
The InChIKey is IMJLPXIWIIDKHO-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H12Br2O2/c1-2-11-7(10)6(9)4-3-5-8/h6H,2-5H2,1H3/t6-/m1/s1.
What are the key properties of ethyl (2R)-2,5-dibromopentanoate?
ethyl (2R)-2,5-dibromopentanoate has a molecular weight of 287.98 g/mol, XLogP of 2.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2,5-dibromopentanoate is sourced from PubChem (CID 98051251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).