C10H13NS — CID 174682957
5-(2-bicyclo[2.2.1]heptanylidene)-4H-1,3-thiazole (PubChem CID 174682957) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]heptanylidene)-4H-1,3-thiazole.
| Compound Name | 5-(2-bicyclo[2.2.1]heptanylidene)-4H-1,3-thiazole |
|---|---|
| PubChem CID | 174682957 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]heptanylidene)-4H-1,3-thiazole |
| SMILES | C1=NCC(=C2CC3CCC2C3)S1 |
| InChI | InChI=1S/C10H13NS/c1-2-8-3-7(1)4-9(8)10-5-11-6-12-10/h6-8H,1-5H2 |
| InChIKey | RZCVCEDNXODWNB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |