C21H23FN4O2 — CID 174683593
[3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-2-fluorophenyl] N-tert-butylcarbamate (PubChem CID 174683593) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is [3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-2-fluorophenyl] N-tert-butylcarbamate.
| Compound Name | [3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-2-fluorophenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174683593 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-2-fluorophenyl] N-tert-butylcarbamate |
| SMILES | CCn1cc(-c2ccncc2)c(-c2cccc(OC(=O)NC(C)(C)C)c2F)n1 |
| InChI | InChI=1S/C21H23FN4O2/c1-5-26-13-16(14-9-11-23-12-10-14)19(25-26)15-7-6-8-17(18(15)22)28-20(27)24-21(2,3)4/h6-13H,5H2,1-4H3,(H,24,27) |
| InChIKey | BTFGYPSYKIYACZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |