C24H23N5O3S — CID 161462862
1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-(3-methylphenyl)urea;sulfur dioxide (PubChem CID 161462862) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-(3-methylphenyl)urea;sulfur dioxide.
| Compound Name | 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-(3-methylphenyl)urea;sulfur dioxide |
|---|---|
| PubChem CID | 161462862 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-(3-methylphenyl)urea;sulfur dioxide |
| SMILES | CCn1cc(-c2cccc(NC(=O)Nc3cccc(C)c3)c2)c(-c2ccncc2)n1.O=S=O |
| InChI | InChI=1S/C24H23N5O.O2S/c1-3-29-16-22(23(28-29)18-10-12-25-13-11-18)19-7-5-9-21(15-19)27-24(30)26-20-8-4-6-17(2)14-20;1-3-2/h4-16H,3H2,1-2H3,(H2,26,27,30); |
| InChIKey | WCAVQWRDNZHTBF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |