C22H21N5O — CID 141182269
1-[4-[1-ethyl-4-(1H-pyrrol-3-yl)pyrazol-3-yl]phenyl]-3-phenylurea (PubChem CID 141182269) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[4-[1-ethyl-4-(1H-pyrrol-3-yl)pyrazol-3-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-ethyl-4-(1H-pyrrol-3-yl)pyrazol-3-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 141182269 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-[4-[1-ethyl-4-(1H-pyrrol-3-yl)pyrazol-3-yl]phenyl]-3-phenylurea |
| SMILES | CCn1cc(-c2cc[nH]c2)c(-c2ccc(NC(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H21N5O/c1-2-27-15-20(17-12-13-23-14-17)21(26-27)16-8-10-19(11-9-16)25-22(28)24-18-6-4-3-5-7-18/h3-15,23H,2H2,1H3,(H2,24,25,28) |
| InChIKey | LNGKOBYBVGYAIQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |