C24H23N5O3 — CID 88948710
1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-1-hydroxy-3-(4-methoxyphenyl)urea (PubChem CID 88948710) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-1-hydroxy-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-1-hydroxy-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 88948710 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-1-hydroxy-3-(4-methoxyphenyl)urea |
| SMILES | CCn1cc(-c2cccc(N(O)C(=O)Nc3ccc(OC)cc3)c2)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C24H23N5O3/c1-3-28-16-22(23(27-28)17-11-13-25-14-12-17)18-5-4-6-20(15-18)29(31)24(30)26-19-7-9-21(32-2)10-8-19/h4-16,31H,3H2,1-2H3,(H,26,30) |
| InChIKey | LAYGZRHBPGSKMB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|