C23H34N8O4 — CID 174705344
bis(1-amino-1-ethyl-3-(4-methoxyphenyl)urea);1H-pyrazole (PubChem CID 174705344) has the molecular formula C23H34N8O4 and a molecular weight of 486.58 g/mol. Its IUPAC name is bis(1-amino-1-ethyl-3-(4-methoxyphenyl)urea);1H-pyrazole.
| Compound Name | bis(1-amino-1-ethyl-3-(4-methoxyphenyl)urea);1H-pyrazole |
|---|---|
| PubChem CID | 174705344 |
| Molecular Formula | C23H34N8O4 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | bis(1-amino-1-ethyl-3-(4-methoxyphenyl)urea);1H-pyrazole |
| SMILES | CCN(N)C(=O)Nc1ccc(OC)cc1.CCN(N)C(=O)Nc1ccc(OC)cc1.c1cn[nH]c1 |
| InChI | InChI=1S/2C10H15N3O2.C3H4N2/c2*1-3-13(11)10(14)12-8-4-6-9(15-2)7-5-8;1-2-4-5-3-1/h2*4-7H,3,11H2,1-2H3,(H,12,14);1-3H,(H,4,5) |
| InChIKey | DMKGULGUCUXRTD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|