C29H30N4O4S — CID 88948726
1-hydroxy-3-(4-methoxyphenyl)-1-[3-[2-[2-(oxan-4-yl)ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea (PubChem CID 88948726) has the molecular formula C29H30N4O4S and a molecular weight of 530.65 g/mol. Its IUPAC name is 1-hydroxy-3-(4-methoxyphenyl)-1-[3-[2-[2-(oxan-4-yl)ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea.
| Compound Name | 1-hydroxy-3-(4-methoxyphenyl)-1-[3-[2-[2-(oxan-4-yl)ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea |
|---|---|
| PubChem CID | 88948726 |
| Molecular Formula | C29H30N4O4S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 1-hydroxy-3-(4-methoxyphenyl)-1-[3-[2-[2-(oxan-4-yl)ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea |
| SMILES | COc1ccc(NC(=O)N(O)c2cccc(-c3sc(CCC4CCOCC4)nc3-c3ccncc3)c2)cc1 |
| InChI | InChI=1S/C29H30N4O4S/c1-36-25-8-6-23(7-9-25)31-29(34)33(35)24-4-2-3-22(19-24)28-27(21-11-15-30-16-12-21)32-26(38-28)10-5-20-13-17-37-18-14-20/h2-4,6-9,11-12,15-16,19-20,35H,5,10,13-14,17-18H2,1H3,(H,31,34) |
| InChIKey | NEALAAZWYLMCNX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|