C24H24N6O3S — CID 66547839
1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea (PubChem CID 66547839) has the molecular formula C24H24N6O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea.
| Compound Name | 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 66547839 |
| Molecular Formula | C24H24N6O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1-[3-(1-ethyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea |
| SMILES | CCn1cc(-c2cccc(NC(=O)Nc3ccc(S(=O)(=O)NC)cc3)c2)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C24H24N6O3S/c1-3-30-16-22(23(29-30)17-11-13-26-14-12-17)18-5-4-6-20(15-18)28-24(31)27-19-7-9-21(10-8-19)34(32,33)25-2/h4-16,25H,3H2,1-2H3,(H2,27,28,31) |
| InChIKey | BCRFFUUXNWNXOI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |