C24H38O4 — CID 174683621
dicyclohexyl 3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-dicarboxylate (PubChem CID 174683621) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is dicyclohexyl 3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-dicarboxylate.
| Compound Name | dicyclohexyl 3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 174683621 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | dicyclohexyl 3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1,1-dicarboxylate |
| SMILES | O=C(OC1CCCCC1)C1(C(=O)OC2CCCCC2)CCCC2CCCCC21 |
| InChI | InChI=1S/C24H38O4/c25-22(27-19-12-3-1-4-13-19)24(23(26)28-20-14-5-2-6-15-20)17-9-11-18-10-7-8-16-21(18)24/h18-21H,1-17H2 |
| InChIKey | DAOBPGYSYWSOFO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|