C23H32N2O2 — CID 174683721
[4-(3,5-dimethyl-1-adamantyl)piperazin-1-yl] benzoate (PubChem CID 174683721) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is [4-(3,5-dimethyl-1-adamantyl)piperazin-1-yl] benzoate.
| Compound Name | [4-(3,5-dimethyl-1-adamantyl)piperazin-1-yl] benzoate |
|---|---|
| PubChem CID | 174683721 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | [4-(3,5-dimethyl-1-adamantyl)piperazin-1-yl] benzoate |
| SMILES | CC12CC3CC(C)(C1)CC(N1CCN(OC(=O)c4ccccc4)CC1)(C3)C2 |
| InChI | InChI=1S/C23H32N2O2/c1-21-12-18-13-22(2,15-21)17-23(14-18,16-21)24-8-10-25(11-9-24)27-20(26)19-6-4-3-5-7-19/h3-7,18H,8-17H2,1-2H3 |
| InChIKey | YHQQSDFGWFEUIP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |