About phenoxysulfinyl 2-aminoacetate
phenoxysulfinyl 2-aminoacetate (PubChem CID 174683728) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is phenoxysulfinyl 2-aminoacetate.
Molecular Properties
| Compound Name | phenoxysulfinyl 2-aminoacetate |
| PubChem CID | 174683728 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | phenoxysulfinyl 2-aminoacetate |
| SMILES | NCC(=O)OS(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H9NO4S/c9-6-8(10)13-14(11)12-7-4-2-1-3-5-7/h1-5H,6,9H2 |
| InChIKey | GTWPRWHAEXJTDB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenoxysulfinyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxysulfinyl 2-aminoacetate?
The IUPAC name of phenoxysulfinyl 2-aminoacetate (CID 174683728) is phenoxysulfinyl 2-aminoacetate.
What is the SMILES notation for phenoxysulfinyl 2-aminoacetate?
The canonical SMILES for phenoxysulfinyl 2-aminoacetate is NCC(=O)OS(=O)Oc1ccccc1.
What is the InChIKey of phenoxysulfinyl 2-aminoacetate?
The InChIKey is GTWPRWHAEXJTDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c9-6-8(10)13-14(11)12-7-4-2-1-3-5-7/h1-5H,6,9H2.
What are the key properties of phenoxysulfinyl 2-aminoacetate?
phenoxysulfinyl 2-aminoacetate has a molecular weight of 215.23 g/mol, XLogP of 0.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxysulfinyl 2-aminoacetate is sourced from PubChem (CID 174683728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).