About phenyl 2-fluoroethanesulfinate
phenyl 2-fluoroethanesulfinate (PubChem CID 91127696) has the molecular formula C8H9FO2S
and a molecular weight of 188.22 g/mol. Its IUPAC name is phenyl 2-fluoroethanesulfinate.
Molecular Properties
| Compound Name | phenyl 2-fluoroethanesulfinate |
| PubChem CID | 91127696 |
| Molecular Formula | C8H9FO2S |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | phenyl 2-fluoroethanesulfinate |
| SMILES | O=S(CCF)Oc1ccccc1 |
| InChI | InChI=1S/C8H9FO2S/c9-6-7-12(10)11-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | DKONUPNZUHJERS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl 2-fluoroethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-fluoroethanesulfinate?
The IUPAC name of phenyl 2-fluoroethanesulfinate (CID 91127696) is phenyl 2-fluoroethanesulfinate.
What is the SMILES notation for phenyl 2-fluoroethanesulfinate?
The canonical SMILES for phenyl 2-fluoroethanesulfinate is O=S(CCF)Oc1ccccc1.
What is the InChIKey of phenyl 2-fluoroethanesulfinate?
The InChIKey is DKONUPNZUHJERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO2S/c9-6-7-12(10)11-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of phenyl 2-fluoroethanesulfinate?
phenyl 2-fluoroethanesulfinate has a molecular weight of 188.22 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-fluoroethanesulfinate is sourced from PubChem (CID 91127696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).