About ethoxyethane;phenyl hydrogen sulfite
ethoxyethane;phenyl hydrogen sulfite (PubChem CID 67022432) has the molecular formula C10H16O4S
and a molecular weight of 232.30 g/mol. Its IUPAC name is ethoxyethane;phenyl hydrogen sulfite.
Molecular Properties
| Compound Name | ethoxyethane;phenyl hydrogen sulfite |
| PubChem CID | 67022432 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | ethoxyethane;phenyl hydrogen sulfite |
| SMILES | CCOCC.O=S(O)Oc1ccccc1 |
| InChI | InChI=1S/C6H6O3S.C4H10O/c7-10(8)9-6-4-2-1-3-5-6;1-3-5-4-2/h1-5H,(H,7,8);3-4H2,1-2H3 |
| InChIKey | ZLOJCWLFFZDFLS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;phenyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;phenyl hydrogen sulfite?
The IUPAC name of ethoxyethane;phenyl hydrogen sulfite (CID 67022432) is ethoxyethane;phenyl hydrogen sulfite.
What is the SMILES notation for ethoxyethane;phenyl hydrogen sulfite?
The canonical SMILES for ethoxyethane;phenyl hydrogen sulfite is CCOCC.O=S(O)Oc1ccccc1.
What is the InChIKey of ethoxyethane;phenyl hydrogen sulfite?
The InChIKey is ZLOJCWLFFZDFLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S.C4H10O/c7-10(8)9-6-4-2-1-3-5-6;1-3-5-4-2/h1-5H,(H,7,8);3-4H2,1-2H3.
What are the key properties of ethoxyethane;phenyl hydrogen sulfite?
ethoxyethane;phenyl hydrogen sulfite has a molecular weight of 232.30 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;phenyl hydrogen sulfite is sourced from PubChem (CID 67022432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).