C7H10BN2 — CID 174685317
CID 174685317 (PubChem CID 174685317) has the molecular formula C7H10BN2 and a molecular weight of 132.98 g/mol.
| Compound Name | CID 174685317 |
|---|---|
| PubChem CID | 174685317 |
| Molecular Formula | C7H10BN2 |
| Molecular Weight | 132.98 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | — |
| SMILES | [B]1CCCC1c1ccn[nH]1 |
| InChI | InChI=1S/C7H10BN2/c1-2-6(8-4-1)7-3-5-9-10-7/h3,5-6H,1-2,4H2,(H,9,10) |
| InChIKey | RWODHZDTJVZFCO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.98 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|