C21H36Na2O7 — CID 174686374
disodium;(Z)-4-hexadecoxy-4-oxobut-2-enoic acid;carbonate (PubChem CID 174686374) has the molecular formula C21H36Na2O7 and a molecular weight of 446.49 g/mol. Its IUPAC name is disodium;(Z)-4-hexadecoxy-4-oxobut-2-enoic acid;carbonate.
| Compound Name | disodium;(Z)-4-hexadecoxy-4-oxobut-2-enoic acid;carbonate |
|---|---|
| PubChem CID | 174686374 |
| Molecular Formula | C21H36Na2O7 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | disodium;(Z)-4-hexadecoxy-4-oxobut-2-enoic acid;carbonate |
| SMILES | CCCCCCCCCCCCCCCCOC(=O)/C=C\C(=O)O.O=C([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H36O4.CH2O3.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-24-20(23)17-16-19(21)22;2-1(3)4;;/h16-17H,2-15,18H2,1H3,(H,21,22);(H2,2,3,4);;/q;;2*+1/p-2/b17-16-;;; |
| InChIKey | ROPHCIIJVCFJAX-WQKNRVTRSA-L |
| XLogP | -2.79 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|