About 1-azido-6-chlorohexane;formic acid
1-azido-6-chlorohexane;formic acid (PubChem CID 174686899) has the molecular formula C7H14ClN3O2
and a molecular weight of 207.66 g/mol. Its IUPAC name is 1-azido-6-chlorohexane;formic acid.
Molecular Properties
| Compound Name | 1-azido-6-chlorohexane;formic acid |
| PubChem CID | 174686899 |
| Molecular Formula | C7H14ClN3O2 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-azido-6-chlorohexane;formic acid |
| SMILES | O=CO.[N-]=[N+]=NCCCCCCCl |
| InChI | InChI=1S/C6H12ClN3.CH2O2/c7-5-3-1-2-4-6-9-10-8;2-1-3/h1-6H2;1H,(H,2,3) |
| InChIKey | BLDYEHHQVBZZTB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-6-chlorohexane;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-6-chlorohexane;formic acid?
The IUPAC name of 1-azido-6-chlorohexane;formic acid (CID 174686899) is 1-azido-6-chlorohexane;formic acid.
What is the SMILES notation for 1-azido-6-chlorohexane;formic acid?
The canonical SMILES for 1-azido-6-chlorohexane;formic acid is O=CO.[N-]=[N+]=NCCCCCCCl.
What is the InChIKey of 1-azido-6-chlorohexane;formic acid?
The InChIKey is BLDYEHHQVBZZTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClN3.CH2O2/c7-5-3-1-2-4-6-9-10-8;2-1-3/h1-6H2;1H,(H,2,3).
What are the key properties of 1-azido-6-chlorohexane;formic acid?
1-azido-6-chlorohexane;formic acid has a molecular weight of 207.66 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-6-chlorohexane;formic acid is sourced from PubChem (CID 174686899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).