C25H27N5O6 — CID 174687726
2-hydroxy-3-[2-[5-(morpholine-4-carbonyl)-1H-pyrazole-3-carbonyl]-2-[(4-phenylphenyl)methyl]hydrazinyl]propanoic acid (PubChem CID 174687726) has the molecular formula C25H27N5O6 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-hydroxy-3-[2-[5-(morpholine-4-carbonyl)-1H-pyrazole-3-carbonyl]-2-[(4-phenylphenyl)methyl]hydrazinyl]propanoic acid.
| Compound Name | 2-hydroxy-3-[2-[5-(morpholine-4-carbonyl)-1H-pyrazole-3-carbonyl]-2-[(4-phenylphenyl)methyl]hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 174687726 |
| Molecular Formula | C25H27N5O6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-hydroxy-3-[2-[5-(morpholine-4-carbonyl)-1H-pyrazole-3-carbonyl]-2-[(4-phenylphenyl)methyl]hydrazinyl]propanoic acid |
| SMILES | O=C(O)C(O)CNN(Cc1ccc(-c2ccccc2)cc1)C(=O)c1cc(C(=O)N2CCOCC2)[nH]n1 |
| InChI | InChI=1S/C25H27N5O6/c31-22(25(34)35)15-26-30(16-17-6-8-19(9-7-17)18-4-2-1-3-5-18)24(33)21-14-20(27-28-21)23(32)29-10-12-36-13-11-29/h1-9,14,22,26,31H,10-13,15-16H2,(H,27,28)(H,34,35) |
| InChIKey | OQWKGZGQKCUAIM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 148.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|