About 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc
5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc (PubChem CID 174687805) has the molecular formula C11H7ClOS2Zn
and a molecular weight of 320.15 g/mol. Its IUPAC name is 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc.
Molecular Properties
| Compound Name | 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc |
| PubChem CID | 174687805 |
| Molecular Formula | C11H7ClOS2Zn |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 317.89 |
| IUPAC Name | 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc |
| SMILES | O=C(Cl)c1csc(-c2ccccc2S)c1.[Zn] |
| InChI | InChI=1S/C11H7ClOS2.Zn/c12-11(13)7-5-10(15-6-7)8-3-1-2-4-9(8)14;/h1-6,14H; |
| InChIKey | CXLIOZJTEWOQQW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc?
The IUPAC name of 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc (CID 174687805) is 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc.
What is the SMILES notation for 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc?
The canonical SMILES for 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc is O=C(Cl)c1csc(-c2ccccc2S)c1.[Zn].
What is the InChIKey of 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc?
The InChIKey is CXLIOZJTEWOQQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClOS2.Zn/c12-11(13)7-5-10(15-6-7)8-3-1-2-4-9(8)14;/h1-6,14H;.
What are the key properties of 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc?
5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc has a molecular weight of 320.15 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-sulfanylphenyl)thiophene-3-carbonyl chloride;zinc is sourced from PubChem (CID 174687805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).