C12H18N4O — CID 174688930
4-[(5-amino-2-pyridinyl)methyl]-1-methylpiperazine-2-carbaldehyde (PubChem CID 174688930) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[(5-amino-2-pyridinyl)methyl]-1-methylpiperazine-2-carbaldehyde.
| Compound Name | 4-[(5-amino-2-pyridinyl)methyl]-1-methylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174688930 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-[(5-amino-2-pyridinyl)methyl]-1-methylpiperazine-2-carbaldehyde |
| SMILES | CN1CCN(Cc2ccc(N)cn2)CC1C=O |
| InChI | InChI=1S/C12H18N4O/c1-15-4-5-16(8-12(15)9-17)7-11-3-2-10(13)6-14-11/h2-3,6,9,12H,4-5,7-8,13H2,1H3 |
| InChIKey | WLOYYRGXUBRAGJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|