C11H15F2N3 — CID 70909979
6-[(4,4-difluoropiperidin-1-yl)methyl]pyridin-3-amine (PubChem CID 70909979) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridin-3-amine.
| Compound Name | 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 70909979 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridin-3-amine |
| SMILES | Nc1ccc(CN2CCC(F)(F)CC2)nc1 |
| InChI | InChI=1S/C11H15F2N3/c12-11(13)3-5-16(6-4-11)8-10-2-1-9(14)7-15-10/h1-2,7H,3-6,8,14H2 |
| InChIKey | PVRNNCSIJLGNSL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |