C24H26ClN5O6 — CID 174688957
2-[3-[(5R)-5-amino-3-imino-2-oxohexyl]-2,4-dioxoquinazolin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 174688957) has the molecular formula C24H26ClN5O6 and a molecular weight of 515.95 g/mol. Its IUPAC name is 2-[3-[(5R)-5-amino-3-imino-2-oxohexyl]-2,4-dioxoquinazolin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[3-[(5R)-5-amino-3-imino-2-oxohexyl]-2,4-dioxoquinazolin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 174688957 |
| Molecular Formula | C24H26ClN5O6 |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 2-[3-[(5R)-5-amino-3-imino-2-oxohexyl]-2,4-dioxoquinazolin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | [H]/N=C(\C[C@@H](C)N)C(=O)Cn1c(=O)c2ccccc2n(CC(=O)Nc2cc(Cl)c(OC)cc2OC)c1=O |
| InChI | InChI=1S/C24H26ClN5O6/c1-13(26)8-16(27)19(31)11-30-23(33)14-6-4-5-7-18(14)29(24(30)34)12-22(32)28-17-9-15(25)20(35-2)10-21(17)36-3/h4-7,9-10,13,27H,8,11-12,26H2,1-3H3,(H,28,32)/b27-16+/t13-/m1/s1 |
| InChIKey | VCMNLJGZVBIAQL-SAWHOSGNSA-N |
| XLogP | 1.80 |
| TPSA | 158.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|