C18H40N2O6S — CID 174689802
bis(N-methyl-N-pentoxyprop-2-en-1-amine);sulfuric acid (PubChem CID 174689802) has the molecular formula C18H40N2O6S and a molecular weight of 412.59 g/mol. Its IUPAC name is bis(N-methyl-N-pentoxyprop-2-en-1-amine);sulfuric acid.
| Compound Name | bis(N-methyl-N-pentoxyprop-2-en-1-amine);sulfuric acid |
|---|---|
| PubChem CID | 174689802 |
| Molecular Formula | C18H40N2O6S |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | bis(N-methyl-N-pentoxyprop-2-en-1-amine);sulfuric acid |
| SMILES | C=CCN(C)OCCCCC.C=CCN(C)OCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H19NO.H2O4S/c2*1-4-6-7-9-11-10(3)8-5-2;1-5(2,3)4/h2*5H,2,4,6-9H2,1,3H3;(H2,1,2,3,4) |
| InChIKey | ZSBIOYBKTKYBJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|