C15H24N4O4 — CID 174690202
(2,5-dioxopyrrol-1-yl) 2-(diaminomethylideneamino)decanoate (PubChem CID 174690202) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 2-(diaminomethylideneamino)decanoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 2-(diaminomethylideneamino)decanoate |
|---|---|
| PubChem CID | 174690202 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 2-(diaminomethylideneamino)decanoate |
| SMILES | CCCCCCCCC(N=C(N)N)C(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H24N4O4/c1-2-3-4-5-6-7-8-11(18-15(16)17)14(22)23-19-12(20)9-10-13(19)21/h9-11H,2-8H2,1H3,(H4,16,17,18) |
| InChIKey | VCDCRJOSULQHTB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|