C13H20N4O4S — CID 158539049
2-(diaminomethylideneamino)-7-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)heptanoic acid (PubChem CID 158539049) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-7-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)heptanoic acid.
| Compound Name | 2-(diaminomethylideneamino)-7-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 158539049 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(diaminomethylideneamino)-7-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)heptanoic acid |
| SMILES | CSC1=CC(=O)N(CCCCCC(N=C(N)N)C(=O)O)C1=O |
| InChI | InChI=1S/C13H20N4O4S/c1-22-9-7-10(18)17(11(9)19)6-4-2-3-5-8(12(20)21)16-13(14)15/h7-8H,2-6H2,1H3,(H,20,21)(H4,14,15,16) |
| InChIKey | JWQGUAJDJZYSGY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|