C19H31N3O8S — CID 58290226
2-methoxyethyl N-[2-[2-[2-[4-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 58290226) has the molecular formula C19H31N3O8S and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-[2-[2-[4-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 2-methoxyethyl N-[2-[2-[2-[4-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 58290226 |
| Molecular Formula | C19H31N3O8S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-methoxyethyl N-[2-[2-[2-[4-(3-methylsulfanyl-2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COCCOC(=O)NCCOCCOCCNC(=O)CCCN1C(=O)C=C(SC)C1=O |
| InChI | InChI=1S/C19H31N3O8S/c1-27-10-13-30-19(26)21-6-9-29-12-11-28-8-5-20-16(23)4-3-7-22-17(24)14-15(31-2)18(22)25/h14H,3-13H2,1-2H3,(H,20,23)(H,21,26) |
| InChIKey | MYMKRFGBQGTDME-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|