C9H23Cl2N3O2 — CID 174690434
4-hydrazinylpiperidine-1-carboxylic acid;propane;dihydrochloride (PubChem CID 174690434) has the molecular formula C9H23Cl2N3O2 and a molecular weight of 276.21 g/mol. Its IUPAC name is 4-hydrazinylpiperidine-1-carboxylic acid;propane;dihydrochloride.
| Compound Name | 4-hydrazinylpiperidine-1-carboxylic acid;propane;dihydrochloride |
|---|---|
| PubChem CID | 174690434 |
| Molecular Formula | C9H23Cl2N3O2 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-hydrazinylpiperidine-1-carboxylic acid;propane;dihydrochloride |
| SMILES | CCC.Cl.Cl.NNC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C6H13N3O2.C3H8.2ClH/c7-8-5-1-3-9(4-2-5)6(10)11;1-3-2;;/h5,8H,1-4,7H2,(H,10,11);3H2,1-2H3;2*1H |
| InChIKey | DZUXSFIUBHPDAN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|