C15H19N3O4S2 — CID 17469327
1-(2-methoxyethyl)-3-(4-sulfamoylphenyl)-1-(thiophen-2-ylmethyl)urea (PubChem CID 17469327) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(4-sulfamoylphenyl)-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(2-methoxyethyl)-3-(4-sulfamoylphenyl)-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 17469327 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(4-sulfamoylphenyl)-1-(thiophen-2-ylmethyl)urea |
| SMILES | COCCN(Cc1cccs1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H19N3O4S2/c1-22-9-8-18(11-13-3-2-10-23-13)15(19)17-12-4-6-14(7-5-12)24(16,20)21/h2-7,10H,8-9,11H2,1H3,(H,17,19)(H2,16,20,21) |
| InChIKey | XUVXLVRNEHYBFC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |