C27H31N3OS — CID 174694419
[1,2-bis(diethylamino)phenothiazin-10-yl]-phenylmethanone (PubChem CID 174694419) has the molecular formula C27H31N3OS and a molecular weight of 445.63 g/mol. Its IUPAC name is [1,2-bis(diethylamino)phenothiazin-10-yl]-phenylmethanone.
| Compound Name | [1,2-bis(diethylamino)phenothiazin-10-yl]-phenylmethanone |
|---|---|
| PubChem CID | 174694419 |
| Molecular Formula | C27H31N3OS |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | [1,2-bis(diethylamino)phenothiazin-10-yl]-phenylmethanone |
| SMILES | CCN(CC)c1ccc2c(c1N(CC)CC)N(C(=O)c1ccccc1)c1ccccc1S2 |
| InChI | InChI=1S/C27H31N3OS/c1-5-28(6-2)22-18-19-24-26(25(22)29(7-3)8-4)30(21-16-12-13-17-23(21)32-24)27(31)20-14-10-9-11-15-20/h9-19H,5-8H2,1-4H3 |
| InChIKey | KMVFNZOLABZXIU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |