C17H16N2O2S — CID 137367001
1-pyrrolidin-1-ylphenothiazine-10-carboxylic acid (PubChem CID 137367001) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylphenothiazine-10-carboxylic acid.
| Compound Name | 1-pyrrolidin-1-ylphenothiazine-10-carboxylic acid |
|---|---|
| PubChem CID | 137367001 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-pyrrolidin-1-ylphenothiazine-10-carboxylic acid |
| SMILES | O=C(O)N1c2ccccc2Sc2cccc(N3CCCC3)c21 |
| InChI | InChI=1S/C17H16N2O2S/c20-17(21)19-12-6-1-2-8-14(12)22-15-9-5-7-13(16(15)19)18-10-3-4-11-18/h1-2,5-9H,3-4,10-11H2,(H,20,21) |
| InChIKey | AOFBTQJGVVYFHH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |