C21H17NO3S — CID 4610092
3-(phenothiazine-10-carbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 4610092) has the molecular formula C21H17NO3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-(phenothiazine-10-carbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-(phenothiazine-10-carbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 4610092 |
| Molecular Formula | C21H17NO3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-(phenothiazine-10-carbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1C2C=CC(C2)C1C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C21H17NO3S/c23-20(18-12-9-10-13(11-12)19(18)21(24)25)22-14-5-1-3-7-16(14)26-17-8-4-2-6-15(17)22/h1-10,12-13,18-19H,11H2,(H,24,25) |
| InChIKey | SMDUYVDADNWSIE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|