C44H58N4O9 — CID 174698427
[2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]methyl hexanoate (PubChem CID 174698427) has the molecular formula C44H58N4O9 and a molecular weight of 786.97 g/mol. Its IUPAC name is [2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]methyl hexanoate.
| Compound Name | [2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]methyl hexanoate |
|---|---|
| PubChem CID | 174698427 |
| Molecular Formula | C44H58N4O9 |
| Molecular Weight | 786.97 g/mol |
| Exact Mass | 786.42 |
| IUPAC Name | [2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]methyl hexanoate |
| SMILES | CCCCCC(=O)OCc1c(NC(=O)OCC2c3ccccc3-c3ccccc32)cccc1NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H58N4O9/c1-8-9-10-25-38(49)54-28-34-35(46-39(50)37(48-42(53)57-44(5,6)7)22-15-16-26-45-40(51)56-43(2,3)4)23-17-24-36(34)47-41(52)55-27-33-31-20-13-11-18-29(31)30-19-12-14-21-32(30)33/h11-14,17-21,23-24,33,37H,8-10,15-16,22,25-28H2,1-7H3,(H,45,51)(H,46,50)(H,47,52)(H,48,53)/t37-/m0/s1 |
| InChIKey | UPVMAXBWEBCTQP-QNGWXLTQSA-N |
| XLogP | 9.20 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.97 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|