C23H50N2O5 — CID 174699083
N,N-dihydroxy-2-(pentylamino)butan-1-amine oxide;tetradecanoic acid (PubChem CID 174699083) has the molecular formula C23H50N2O5 and a molecular weight of 434.66 g/mol. Its IUPAC name is N,N-dihydroxy-2-(pentylamino)butan-1-amine oxide;tetradecanoic acid.
| Compound Name | N,N-dihydroxy-2-(pentylamino)butan-1-amine oxide;tetradecanoic acid |
|---|---|
| PubChem CID | 174699083 |
| Molecular Formula | C23H50N2O5 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.37 |
| IUPAC Name | N,N-dihydroxy-2-(pentylamino)butan-1-amine oxide;tetradecanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)O.CCCCCNC(CC)C[N+]([O-])(O)O |
| InChI | InChI=1S/C14H28O2.C9H22N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-3-5-6-7-10-9(4-2)8-11(12,13)14/h2-13H2,1H3,(H,15,16);9-10,12-13H,3-8H2,1-2H3 |
| InChIKey | CMSNXDMDSXKZOV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|