C15H10Cl2N6O — CID 174701900
bis(4-chloro-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)methanone (PubChem CID 174701900) has the molecular formula C15H10Cl2N6O and a molecular weight of 361.19 g/mol. Its IUPAC name is bis(4-chloro-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)methanone.
| Compound Name | bis(4-chloro-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 174701900 |
| Molecular Formula | C15H10Cl2N6O |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | bis(4-chloro-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)methanone |
| SMILES | Cn1cc(C(=O)c2cn(C)c3ncnc(Cl)c23)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C15H10Cl2N6O/c1-22-3-7(9-12(16)18-5-20-14(9)22)11(24)8-4-23(2)15-10(8)13(17)19-6-21-15/h3-6H,1-2H3 |
| InChIKey | ANWIOKZPDARKJY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |