About 2,9-dichloronon-1-en-1-one
2,9-dichloronon-1-en-1-one (PubChem CID 174703689) has the molecular formula C9H14Cl2O
and a molecular weight of 209.12 g/mol. Its IUPAC name is 2,9-dichloronon-1-en-1-one.
Molecular Properties
| Compound Name | 2,9-dichloronon-1-en-1-one |
| PubChem CID | 174703689 |
| Molecular Formula | C9H14Cl2O |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2,9-dichloronon-1-en-1-one |
| SMILES | O=C=C(Cl)CCCCCCCCl |
| InChI | InChI=1S/C9H14Cl2O/c10-7-5-3-1-2-4-6-9(11)8-12/h1-7H2 |
| InChIKey | NYGWRQFKHOLZIL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dichloronon-1-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dichloronon-1-en-1-one?
The IUPAC name of 2,9-dichloronon-1-en-1-one (CID 174703689) is 2,9-dichloronon-1-en-1-one.
What is the SMILES notation for 2,9-dichloronon-1-en-1-one?
The canonical SMILES for 2,9-dichloronon-1-en-1-one is O=C=C(Cl)CCCCCCCCl.
What is the InChIKey of 2,9-dichloronon-1-en-1-one?
The InChIKey is NYGWRQFKHOLZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14Cl2O/c10-7-5-3-1-2-4-6-9(11)8-12/h1-7H2.
What are the key properties of 2,9-dichloronon-1-en-1-one?
2,9-dichloronon-1-en-1-one has a molecular weight of 209.12 g/mol, XLogP of 3.52, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dichloronon-1-en-1-one is sourced from PubChem (CID 174703689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).