C20H20N2O3S2 — CID 17470518
4-[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine (PubChem CID 17470518) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 17470518 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(-c2csc(Cc3ccccc3)n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H20N2O3S2/c23-27(24,22-10-12-25-13-11-22)18-8-6-17(7-9-18)19-15-26-20(21-19)14-16-4-2-1-3-5-16/h1-9,15H,10-14H2 |
| InChIKey | KZWYQPQUZJPRAW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |