C22H40N2O6 — CID 174706308
(Z)-2,2-bis[(2-hydroxyacetyl)amino]octadec-9-enoic acid (PubChem CID 174706308) has the molecular formula C22H40N2O6 and a molecular weight of 428.57 g/mol. Its IUPAC name is (Z)-2,2-bis[(2-hydroxyacetyl)amino]octadec-9-enoic acid.
| Compound Name | (Z)-2,2-bis[(2-hydroxyacetyl)amino]octadec-9-enoic acid |
|---|---|
| PubChem CID | 174706308 |
| Molecular Formula | C22H40N2O6 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (Z)-2,2-bis[(2-hydroxyacetyl)amino]octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCC(NC(=O)CO)(NC(=O)CO)C(=O)O |
| InChI | InChI=1S/C22H40N2O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22(21(29)30,23-19(27)17-25)24-20(28)18-26/h9-10,25-26H,2-8,11-18H2,1H3,(H,23,27)(H,24,28)(H,29,30)/b10-9- |
| InChIKey | TUIWMBPEMYDJIQ-KTKRTIGZSA-N |
| XLogP | 2.63 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|