C20H19F3N6O — CID 174707827
4-[6-amino-4-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-N-phenylpyrimidin-2-amine (PubChem CID 174707827) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is 4-[6-amino-4-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-N-phenylpyrimidin-2-amine.
| Compound Name | 4-[6-amino-4-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 174707827 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-[6-amino-4-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-N-phenylpyrimidin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)c(-c2cc(N3CCOCC3)nc(Nc3ccccc3)n2)cn1 |
| InChI | InChI=1S/C20H19F3N6O/c21-20(22,23)15-10-17(24)25-12-14(15)16-11-18(29-6-8-30-9-7-29)28-19(27-16)26-13-4-2-1-3-5-13/h1-5,10-12H,6-9H2,(H2,24,25)(H,26,27,28) |
| InChIKey | SUCFFMMSTZXSKX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |