C43H38F3N3O — CID 174710854
2H-phthalazin-1-one;N-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 174710854) has the molecular formula C43H38F3N3O and a molecular weight of 669.79 g/mol. Its IUPAC name is 2H-phthalazin-1-one;N-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2H-phthalazin-1-one;N-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 174710854 |
| Molecular Formula | C43H38F3N3O |
| Molecular Weight | 669.79 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | 2H-phthalazin-1-one;N-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | FC(F)(F)c1cccc(CCNCc2ccc(Cc3cccc4ccc5c(c34)CCC3=C5C=CCC3)cc2)c1.O=c1[nH]ncc2ccccc12 |
| InChI | InChI=1S/C35H32F3N.C8H6N2O/c36-35(37,38)30-9-3-5-24(22-30)19-20-39-23-26-13-11-25(12-14-26)21-29-8-4-7-28-16-17-32-31-10-2-1-6-27(31)15-18-33(32)34(28)29;11-8-7-4-2-1-3-6(7)5-9-10-8/h2-5,7-14,16-17,22,39H,1,6,15,18-21,23H2;1-5H,(H,10,11) |
| InChIKey | PXUMOZNAMUEJCG-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.79 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|