C34H29N3O3 — CID 174699925
10-[2-(3-nitrophenyl)ethyl]-1,2,11,12-tetrahydrochrysene;2H-phthalazin-1-one (PubChem CID 174699925) has the molecular formula C34H29N3O3 and a molecular weight of 527.62 g/mol. Its IUPAC name is 10-[2-(3-nitrophenyl)ethyl]-1,2,11,12-tetrahydrochrysene;2H-phthalazin-1-one.
| Compound Name | 10-[2-(3-nitrophenyl)ethyl]-1,2,11,12-tetrahydrochrysene;2H-phthalazin-1-one |
|---|---|
| PubChem CID | 174699925 |
| Molecular Formula | C34H29N3O3 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 10-[2-(3-nitrophenyl)ethyl]-1,2,11,12-tetrahydrochrysene;2H-phthalazin-1-one |
| SMILES | O=[N+]([O-])c1cccc(CCc2cccc3ccc4c(c23)CCC2=C4C=CCC2)c1.O=c1[nH]ncc2ccccc12 |
| InChI | InChI=1S/C26H23NO2.C8H6N2O/c28-27(29)22-9-3-5-18(17-22)11-12-20-7-4-8-21-14-15-24-23-10-2-1-6-19(23)13-16-25(24)26(20)21;11-8-7-4-2-1-3-6(7)5-9-10-8/h2-5,7-10,14-15,17H,1,6,11-13,16H2;1-5H,(H,10,11) |
| InChIKey | SHYLXNPTYGNZON-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|