C22H34O6 — CID 174711303
7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate (PubChem CID 174711303) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate.
| Compound Name | 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate |
|---|---|
| PubChem CID | 174711303 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate |
| SMILES | C=C(CCCCCC)C(=O)OCC.CC1(C)C2C=CC1C(C(=O)O)C2C(=O)O |
| InChI | InChI=1S/C11H14O4.C11H20O2/c1-11(2)5-3-4-6(11)8(10(14)15)7(5)9(12)13;1-4-6-7-8-9-10(3)11(12)13-5-2/h3-8H,1-2H3,(H,12,13)(H,14,15);3-9H2,1-2H3 |
| InChIKey | MAQRYTOZNLGWEN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|