C20H30O6 — CID 174711281
bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate (PubChem CID 174711281) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate.
| Compound Name | bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate |
|---|---|
| PubChem CID | 174711281 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic acid;ethyl 2-methylideneoctanoate |
| SMILES | C=C(CCCCCC)C(=O)OCC.O=C(O)C1=C(C(=O)O)C2CCC1C2 |
| InChI | InChI=1S/C11H20O2.C9H10O4/c1-4-6-7-8-9-10(3)11(12)13-5-2;10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h3-9H2,1-2H3;4-5H,1-3H2,(H,10,11)(H,12,13) |
| InChIKey | PIUBONZAUMEONC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|