C13H21NO4 — CID 174711752
1-butanoyl-3-pentoxypyrrolidine-2,5-dione (PubChem CID 174711752) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-butanoyl-3-pentoxypyrrolidine-2,5-dione.
| Compound Name | 1-butanoyl-3-pentoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174711752 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-butanoyl-3-pentoxypyrrolidine-2,5-dione |
| SMILES | CCCCCOC1CC(=O)N(C(=O)CCC)C1=O |
| InChI | InChI=1S/C13H21NO4/c1-3-5-6-8-18-10-9-12(16)14(13(10)17)11(15)7-4-2/h10H,3-9H2,1-2H3 |
| InChIKey | NGAJXGIEWGBHEY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|