6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride

C13H20FNO4 — CID 145323329

IUPAC6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride
SMILESCCCOC1CC(=O)N(CCCCCC(=O)F)C1=O
InChIInChI=1S/C13H20FNO4/c1-2-8-19-10-9-12(17)15(13(10)18)7-5-3-4-6-11(14)16/h10H,2-9H2,1H3
InChIKeyJBPQECGSQBXAKV-UHFFFAOYSA-N
MW273.30 g/mol
LogP1.60
Rot. Bonds9

About 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride

6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride (PubChem CID 145323329) has the molecular formula C13H20FNO4 and a molecular weight of 273.30 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride.

Molecular Properties

Compound Name6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride
PubChem CID145323329
Molecular FormulaC13H20FNO4
Molecular Weight273.30 g/mol
Exact Mass273.14
IUPAC Name6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride
SMILESCCCOC1CC(=O)N(CCCCCC(=O)F)C1=O
InChIInChI=1S/C13H20FNO4/c1-2-8-19-10-9-12(17)15(13(10)18)7-5-3-4-6-11(14)16/h10H,2-9H2,1H3
InChIKeyJBPQECGSQBXAKV-UHFFFAOYSA-N
XLogP1.60
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.30
LogP ≤ 51.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride?
The IUPAC name of 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride (CID 145323329) is 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride.
What is the SMILES notation for 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride?
The canonical SMILES for 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride is CCCOC1CC(=O)N(CCCCCC(=O)F)C1=O.
What is the InChIKey of 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride?
The InChIKey is JBPQECGSQBXAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FNO4/c1-2-8-19-10-9-12(17)15(13(10)18)7-5-3-4-6-11(14)16/h10H,2-9H2,1H3.
What are the key properties of 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride?
6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride has a molecular weight of 273.30 g/mol, XLogP of 1.60, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride is sourced from PubChem (CID 145323329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).