C13H20FNO4 — CID 145323329
6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride (PubChem CID 145323329) has the molecular formula C13H20FNO4 and a molecular weight of 273.30 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride.
| Compound Name | 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride |
|---|---|
| PubChem CID | 145323329 |
| Molecular Formula | C13H20FNO4 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 6-(2,5-dioxo-3-propoxypyrrolidin-1-yl)hexanoyl fluoride |
| SMILES | CCCOC1CC(=O)N(CCCCCC(=O)F)C1=O |
| InChI | InChI=1S/C13H20FNO4/c1-2-8-19-10-9-12(17)15(13(10)18)7-5-3-4-6-11(14)16/h10H,2-9H2,1H3 |
| InChIKey | JBPQECGSQBXAKV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|