C13H7Cl6N3O — CID 174712271
2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 174712271) has the molecular formula C13H7Cl6N3O and a molecular weight of 433.94 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 174712271 |
| Molecular Formula | C13H7Cl6N3O |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 430.87 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1nc(C2Cc3ccccc3O2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C13H7Cl6N3O/c14-12(15,16)10-20-9(21-11(22-10)13(17,18)19)8-5-6-3-1-2-4-7(6)23-8/h1-4,8H,5H2 |
| InChIKey | DAHUYSRLXZHWOI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|