C18H22N4O — CID 174713516
1-benzyl-4,5-dihydroimidazole;(2-methylphenyl)urea (PubChem CID 174713516) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-benzyl-4,5-dihydroimidazole;(2-methylphenyl)urea.
| Compound Name | 1-benzyl-4,5-dihydroimidazole;(2-methylphenyl)urea |
|---|---|
| PubChem CID | 174713516 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-benzyl-4,5-dihydroimidazole;(2-methylphenyl)urea |
| SMILES | C1=NCCN1Cc1ccccc1.Cc1ccccc1NC(N)=O |
| InChI | InChI=1S/C10H12N2.C8H10N2O/c1-2-4-10(5-3-1)8-12-7-6-11-9-12;1-6-4-2-3-5-7(6)10-8(9)11/h1-5,9H,6-8H2;2-5H,1H3,(H3,9,10,11) |
| InChIKey | VNUFOCZHYIXWLX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |