C29H30N6O6S2 — CID 174713891
1-[4-(aminomethyl)phenyl]sulfonyl-3-[[[4-(aminomethyl)phenyl]sulfonylcarbamoylamino]-diphenylmethyl]urea (PubChem CID 174713891) has the molecular formula C29H30N6O6S2 and a molecular weight of 622.73 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]sulfonyl-3-[[[4-(aminomethyl)phenyl]sulfonylcarbamoylamino]-diphenylmethyl]urea.
| Compound Name | 1-[4-(aminomethyl)phenyl]sulfonyl-3-[[[4-(aminomethyl)phenyl]sulfonylcarbamoylamino]-diphenylmethyl]urea |
|---|---|
| PubChem CID | 174713891 |
| Molecular Formula | C29H30N6O6S2 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]sulfonyl-3-[[[4-(aminomethyl)phenyl]sulfonylcarbamoylamino]-diphenylmethyl]urea |
| SMILES | NCc1ccc(S(=O)(=O)NC(=O)NC(NC(=O)NS(=O)(=O)c2ccc(CN)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N6O6S2/c30-19-21-11-15-25(16-12-21)42(38,39)34-27(36)32-29(23-7-3-1-4-8-23,24-9-5-2-6-10-24)33-28(37)35-43(40,41)26-17-13-22(20-31)14-18-26/h1-18H,19-20,30-31H2,(H2,32,34,36)(H2,33,35,37) |
| InChIKey | GPVXEUHTOBWVPY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 202.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|