C21H21N3O — CID 174714308
4-amino-2,3-bis[3-(aminomethyl)phenyl]benzaldehyde (PubChem CID 174714308) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-amino-2,3-bis[3-(aminomethyl)phenyl]benzaldehyde.
| Compound Name | 4-amino-2,3-bis[3-(aminomethyl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 174714308 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-amino-2,3-bis[3-(aminomethyl)phenyl]benzaldehyde |
| SMILES | NCc1cccc(-c2c(N)ccc(C=O)c2-c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C21H21N3O/c22-11-14-3-1-5-16(9-14)20-18(13-25)7-8-19(24)21(20)17-6-2-4-15(10-17)12-23/h1-10,13H,11-12,22-24H2 |
| InChIKey | UOFLPKUKZULYOR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|